C25H29N3O4 — CID 135001605
[(S)-[5-[(1Z,3E)-5-amino-5-oxopenta-1,3-dienyl]-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate (PubChem CID 135001605) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(S)-[5-[(1Z,3E)-5-amino-5-oxopenta-1,3-dienyl]-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate.
| Compound Name | [(S)-[5-[(1Z,3E)-5-amino-5-oxopenta-1,3-dienyl]-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate |
|---|---|
| PubChem CID | 135001605 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [(S)-[5-[(1Z,3E)-5-amino-5-oxopenta-1,3-dienyl]-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate |
| SMILES | COc1ccc2nccc([C@H](OC(C)=O)C3CC4CCN3CC4/C=C\C=C\C(N)=O)c2c1 |
| InChI | InChI=1S/C25H29N3O4/c1-16(29)32-25(20-9-11-27-22-8-7-19(31-2)14-21(20)22)23-13-17-10-12-28(23)15-18(17)5-3-4-6-24(26)30/h3-9,11,14,17-18,23,25H,10,12-13,15H2,1-2H3,(H2,26,30)/b5-3-,6-4+/t17?,18?,23?,25-/m0/s1 |
| InChIKey | UBLYXABKKMKGIO-NBBLBAFDSA-N |
| XLogP | 3.16 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|