C26H27NO4 — CID 135002530
N-tert-butyl-5,6-dimethoxy-3-phenoxy-3-phenyl-2-benzofuran-1-imine (PubChem CID 135002530) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-tert-butyl-5,6-dimethoxy-3-phenoxy-3-phenyl-2-benzofuran-1-imine.
| Compound Name | N-tert-butyl-5,6-dimethoxy-3-phenoxy-3-phenyl-2-benzofuran-1-imine |
|---|---|
| PubChem CID | 135002530 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-tert-butyl-5,6-dimethoxy-3-phenoxy-3-phenyl-2-benzofuran-1-imine |
| SMILES | COc1cc2c(cc1OC)C(Oc1ccccc1)(c1ccccc1)O/C2=N\C(C)(C)C |
| InChI | InChI=1S/C26H27NO4/c1-25(2,3)27-24-20-16-22(28-4)23(29-5)17-21(20)26(31-24,18-12-8-6-9-13-18)30-19-14-10-7-11-15-19/h6-17H,1-5H3/b27-24- |
| InChIKey | WMNDRQDGPPELLQ-PNHLSOANSA-N |
| XLogP | 5.56 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|