C21H19F3N2O8 — CID 135002709
dimethyl 2-[(E)-2-ethoxyethenyl]-8-nitro-2-(trifluoromethyl)-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate (PubChem CID 135002709) has the molecular formula C21H19F3N2O8 and a molecular weight of 484.38 g/mol. Its IUPAC name is dimethyl 2-[(E)-2-ethoxyethenyl]-8-nitro-2-(trifluoromethyl)-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-2-ethoxyethenyl]-8-nitro-2-(trifluoromethyl)-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135002709 |
| Molecular Formula | C21H19F3N2O8 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | dimethyl 2-[(E)-2-ethoxyethenyl]-8-nitro-2-(trifluoromethyl)-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
| SMILES | CCO/C=C/C1(C(F)(F)F)OC2c3cccc([N+](=O)[O-])c3C=CN2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C21H19F3N2O8/c1-4-33-11-9-20(21(22,23)24)15(18(27)31-2)16(19(28)32-3)25-10-8-12-13(17(25)34-20)6-5-7-14(12)26(29)30/h5-11,17H,4H2,1-3H3/b11-9+ |
| InChIKey | CMDJQTHSQGLBML-PKNBQFBNSA-N |
| XLogP | 3.36 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|