C18H22N2O5 — CID 135002893
5-O-ethyl 3-O-methyl (4aS,5R,10bS)-7-hydroxy-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-3,5-dicarboxylate (PubChem CID 135002893) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl (4aS,5R,10bS)-7-hydroxy-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl (4aS,5R,10bS)-7-hydroxy-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135002893 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 5-O-ethyl 3-O-methyl (4aS,5R,10bS)-7-hydroxy-1-methyl-4a,5,6,10b-tetrahydro-4H-benzo[h][1,6]naphthyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1Nc2c(O)cccc2[C@@H]2[C@H]1CC(C(=O)OC)=CN2C |
| InChI | InChI=1S/C18H22N2O5/c1-4-25-18(23)15-12-8-10(17(22)24-3)9-20(2)16(12)11-6-5-7-13(21)14(11)19-15/h5-7,9,12,15-16,19,21H,4,8H2,1-3H3/t12-,15+,16+/m0/s1 |
| InChIKey | ODSUOPCJGXHQMZ-APHBMKBZSA-N |
| XLogP | 1.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|