C22H37N3O6 — CID 135004643
2-O,4-O-diethyl 6-O-methyl (2R,4R,4aS,8aS)-8-methyl-1,3-di(propan-2-yl)-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4,6-tricarboxylate (PubChem CID 135004643) has the molecular formula C22H37N3O6 and a molecular weight of 439.55 g/mol. Its IUPAC name is 2-O,4-O-diethyl 6-O-methyl (2R,4R,4aS,8aS)-8-methyl-1,3-di(propan-2-yl)-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4,6-tricarboxylate.
| Compound Name | 2-O,4-O-diethyl 6-O-methyl (2R,4R,4aS,8aS)-8-methyl-1,3-di(propan-2-yl)-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4,6-tricarboxylate |
|---|---|
| PubChem CID | 135004643 |
| Molecular Formula | C22H37N3O6 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-O,4-O-diethyl 6-O-methyl (2R,4R,4aS,8aS)-8-methyl-1,3-di(propan-2-yl)-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4,6-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1N(C(C)C)[C@@H](C(=O)OCC)[C@@H]2CC(C(=O)OC)=CN(C)[C@H]2N1C(C)C |
| InChI | InChI=1S/C22H37N3O6/c1-9-30-21(27)17-16-11-15(20(26)29-8)12-23(7)18(16)25(14(5)6)19(22(28)31-10-2)24(17)13(3)4/h12-14,16-19H,9-11H2,1-8H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | LPCFWYITSHPRQQ-ZSYWTGECSA-N |
| XLogP | 1.58 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|