C29H34N4O4 — CID 135004667
diethyl (2R,4R,4aS,8aS)-1,3-dibenzyl-6-cyano-8-methyl-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4-dicarboxylate (PubChem CID 135004667) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is diethyl (2R,4R,4aS,8aS)-1,3-dibenzyl-6-cyano-8-methyl-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4-dicarboxylate.
| Compound Name | diethyl (2R,4R,4aS,8aS)-1,3-dibenzyl-6-cyano-8-methyl-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135004667 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | diethyl (2R,4R,4aS,8aS)-1,3-dibenzyl-6-cyano-8-methyl-4,4a,5,8a-tetrahydro-2H-pyrido[2,3-d]pyrimidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1N(Cc2ccccc2)[C@@H](C(=O)OCC)[C@@H]2CC(C#N)=CN(C)[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C29H34N4O4/c1-4-36-28(34)25-24-16-23(17-30)18-31(3)26(24)33(20-22-14-10-7-11-15-22)27(29(35)37-5-2)32(25)19-21-12-8-6-9-13-21/h6-15,18,24-27H,4-5,16,19-20H2,1-3H3/t24-,25+,26-,27+/m0/s1 |
| InChIKey | KHBZGZNXGIFBGV-YYGZZXRFSA-N |
| XLogP | 3.51 |
| TPSA | 86.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |