C18H25NO3 — CID 135004473
(4Z)-4-(7-methoxy-3-piperidin-1-yl-3H-1-benzofuran-2-ylidene)butan-2-ol (PubChem CID 135004473) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (4Z)-4-(7-methoxy-3-piperidin-1-yl-3H-1-benzofuran-2-ylidene)butan-2-ol.
| Compound Name | (4Z)-4-(7-methoxy-3-piperidin-1-yl-3H-1-benzofuran-2-ylidene)butan-2-ol |
|---|---|
| PubChem CID | 135004473 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (4Z)-4-(7-methoxy-3-piperidin-1-yl-3H-1-benzofuran-2-ylidene)butan-2-ol |
| SMILES | COc1cccc2c1O/C(=C\CC(C)O)C2N1CCCCC1 |
| InChI | InChI=1S/C18H25NO3/c1-13(20)9-10-15-17(19-11-4-3-5-12-19)14-7-6-8-16(21-2)18(14)22-15/h6-8,10,13,17,20H,3-5,9,11-12H2,1-2H3/b15-10- |
| InChIKey | RPKXGTWRAOZBNH-GDNBJRDFSA-N |
| XLogP | 3.27 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |