C33H39NO5 — CID 135004828
ethyl 3-[(3S,10R,13S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate (PubChem CID 135004828) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is ethyl 3-[(3S,10R,13S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate.
| Compound Name | ethyl 3-[(3S,10R,13S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 135004828 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | ethyl 3-[(3S,10R,13S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)C2=CCC3C4CC=C5C[C@@H](OC(C)=O)CC[C@]5(C)C4CC[C@]23C)n2ccccc12 |
| InChI | InChI=1S/C33H39NO5/c1-5-38-31(37)24-19-29(34-17-7-6-8-28(24)34)30(36)27-12-11-25-23-10-9-21-18-22(39-20(2)35)13-15-32(21,3)26(23)14-16-33(25,27)4/h6-9,12,17,19,22-23,25-26H,5,10-11,13-16,18H2,1-4H3/t22-,23?,25?,26?,32-,33-/m0/s1 |
| InChIKey | NSIDTHANDPJHKE-AULNZKKASA-N |
| XLogP | 6.73 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|