C38H41NO5 — CID 135004829
ethyl 3-[(3S,10R,13S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate (PubChem CID 135004829) has the molecular formula C38H41NO5 and a molecular weight of 591.75 g/mol. Its IUPAC name is ethyl 3-[(3S,10R,13S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate.
| Compound Name | ethyl 3-[(3S,10R,13S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 135004829 |
| Molecular Formula | C38H41NO5 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | ethyl 3-[(3S,10R,13S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)C2=CCC3C4CC=C5C[C@@H](OC(=O)c6ccccc6)CC[C@]5(C)C4CC[C@]23C)n2ccccc12 |
| InChI | InChI=1S/C38H41NO5/c1-4-43-36(42)28-23-33(39-21-9-8-12-32(28)39)34(40)31-16-15-29-27-14-13-25-22-26(44-35(41)24-10-6-5-7-11-24)17-19-37(25,2)30(27)18-20-38(29,31)3/h5-13,16,21,23,26-27,29-30H,4,14-15,17-20,22H2,1-3H3/t26-,27?,29?,30?,37-,38-/m0/s1 |
| InChIKey | ONFRZNHUCAWPSJ-TVPBHMQESA-N |
| XLogP | 8.02 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|