C17H17ClO — CID 135004931
2-[(1E)-1-chloro-1-ethoxypenta-1,4-dien-2-yl]naphthalene (PubChem CID 135004931) has the molecular formula C17H17ClO and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-[(1E)-1-chloro-1-ethoxypenta-1,4-dien-2-yl]naphthalene.
| Compound Name | 2-[(1E)-1-chloro-1-ethoxypenta-1,4-dien-2-yl]naphthalene |
|---|---|
| PubChem CID | 135004931 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[(1E)-1-chloro-1-ethoxypenta-1,4-dien-2-yl]naphthalene |
| SMILES | C=CC/C(=C(\Cl)OCC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H17ClO/c1-3-7-16(17(18)19-4-2)15-11-10-13-8-5-6-9-14(13)12-15/h3,5-6,8-12H,1,4,7H2,2H3/b17-16- |
| InChIKey | WEYQNAVBRRDLQY-MSUUIHNZSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|