C21H26BrNO — CID 135009224
1-(6-bromo-2-pyridinyl)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol (PubChem CID 135009224) has the molecular formula C21H26BrNO and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-(6-bromo-2-pyridinyl)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol.
| Compound Name | 1-(6-bromo-2-pyridinyl)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 135009224 |
| Molecular Formula | C21H26BrNO |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-(6-bromo-2-pyridinyl)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(O)(c2cccc(Br)n2)C1 |
| InChI | InChI=1S/C21H26BrNO/c1-15-12-13-17(20(2,3)16-8-5-4-6-9-16)21(24,14-15)18-10-7-11-19(22)23-18/h4-11,15,17,24H,12-14H2,1-3H3 |
| InChIKey | KPZDRSWYYWHNFG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|