C15H34N2O7P2 — CID 135009230
N'-[1,3-bis(diethoxyphosphoryl)-3-methylbutyl]acetohydrazide (PubChem CID 135009230) has the molecular formula C15H34N2O7P2 and a molecular weight of 416.39 g/mol. Its IUPAC name is N'-[1,3-bis(diethoxyphosphoryl)-3-methylbutyl]acetohydrazide.
| Compound Name | N'-[1,3-bis(diethoxyphosphoryl)-3-methylbutyl]acetohydrazide |
|---|---|
| PubChem CID | 135009230 |
| Molecular Formula | C15H34N2O7P2 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N'-[1,3-bis(diethoxyphosphoryl)-3-methylbutyl]acetohydrazide |
| SMILES | CCOP(=O)(OCC)C(CC(C)(C)P(=O)(OCC)OCC)NNC(C)=O |
| InChI | InChI=1S/C15H34N2O7P2/c1-8-21-25(19,22-9-2)14(17-16-13(5)18)12-15(6,7)26(20,23-10-3)24-11-4/h14,17H,8-12H2,1-7H3,(H,16,18) |
| InChIKey | GNYKFOFSZRVBAX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|