C17H15NO2 — CID 135009590
11,15-dimethyl-12-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaen-10-one (PubChem CID 135009590) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 11,15-dimethyl-12-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaen-10-one.
| Compound Name | 11,15-dimethyl-12-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaen-10-one |
|---|---|
| PubChem CID | 135009590 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 11,15-dimethyl-12-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,13,15-hexaen-10-one |
| SMILES | Cc1cc2c3c(c1)-c1ccccc1CN3C(=O)C(C)O2 |
| InChI | InChI=1S/C17H15NO2/c1-10-7-14-13-6-4-3-5-12(13)9-18-16(14)15(8-10)20-11(2)17(18)19/h3-8,11H,9H2,1-2H3 |
| InChIKey | CHKRTUDIMAUTAZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |