C18H27NO4Si — CID 135010316
benzyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-2-carboxylate (PubChem CID 135010316) has the molecular formula C18H27NO4Si and a molecular weight of 349.50 g/mol. Its IUPAC name is benzyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-2-carboxylate.
| Compound Name | benzyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135010316 |
| Molecular Formula | C18H27NO4Si |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | benzyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(C(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C18H27NO4Si/c1-18(2,3)24(4,5)23-15-11-14(19-16(15)20)17(21)22-12-13-9-7-6-8-10-13/h6-10,14-15H,11-12H2,1-5H3,(H,19,20)/t14?,15-/m0/s1 |
| InChIKey | FQGCVQJNDYBSNE-LOACHALJSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|