C19H29NOSi — CID 135010370
tert-butyl-dimethyl-[[(1S,5S,6R)-1-methyl-3-phenyl-2-azabicyclo[3.2.0]hept-2-en-6-yl]oxy]silane (PubChem CID 135010370) has the molecular formula C19H29NOSi and a molecular weight of 315.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,5S,6R)-1-methyl-3-phenyl-2-azabicyclo[3.2.0]hept-2-en-6-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,5S,6R)-1-methyl-3-phenyl-2-azabicyclo[3.2.0]hept-2-en-6-yl]oxy]silane |
|---|---|
| PubChem CID | 135010370 |
| Molecular Formula | C19H29NOSi |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,5S,6R)-1-methyl-3-phenyl-2-azabicyclo[3.2.0]hept-2-en-6-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@]2(C)N=C(c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C19H29NOSi/c1-18(2,3)22(5,6)21-17-13-19(4)15(17)12-16(20-19)14-10-8-7-9-11-14/h7-11,15,17H,12-13H2,1-6H3/t15-,17-,19+/m1/s1 |
| InChIKey | CAOGGTNOFAZUNO-SUMDDJOVSA-N |
| XLogP | 5.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|