C17H25NOSi — CID 14788495
trimethyl-[[(4R,6R)-3-phenyl-4-prop-2-enyl-5,6-dihydro-4H-oxazin-6-yl]methyl]silane (PubChem CID 14788495) has the molecular formula C17H25NOSi and a molecular weight of 287.48 g/mol. Its IUPAC name is trimethyl-[[(4R,6R)-3-phenyl-4-prop-2-enyl-5,6-dihydro-4H-oxazin-6-yl]methyl]silane.
| Compound Name | trimethyl-[[(4R,6R)-3-phenyl-4-prop-2-enyl-5,6-dihydro-4H-oxazin-6-yl]methyl]silane |
|---|---|
| PubChem CID | 14788495 |
| Molecular Formula | C17H25NOSi |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | trimethyl-[[(4R,6R)-3-phenyl-4-prop-2-enyl-5,6-dihydro-4H-oxazin-6-yl]methyl]silane |
| SMILES | C=CC[C@@H]1C[C@H](C[Si](C)(C)C)ON=C1c1ccccc1 |
| InChI | InChI=1S/C17H25NOSi/c1-5-9-15-12-16(13-20(2,3)4)19-18-17(15)14-10-7-6-8-11-14/h5-8,10-11,15-16H,1,9,12-13H2,2-4H3/t15-,16-/m1/s1 |
| InChIKey | PCMSEXGXIMHZCY-HZPDHXFCSA-N |
| XLogP | 4.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|