C18H19NO — CID 24881813
3-benzyl-5-(2-phenylethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 24881813) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-benzyl-5-(2-phenylethyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-benzyl-5-(2-phenylethyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 24881813 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-benzyl-5-(2-phenylethyl)-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(CCC2CC(Cc3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C18H19NO/c1-3-7-15(8-4-1)11-12-18-14-17(19-20-18)13-16-9-5-2-6-10-16/h1-10,18H,11-14H2 |
| InChIKey | NASJEDRGLZZGAO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |