C17H32O2Si — CID 135010388
(E)-3-[(1R,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol (PubChem CID 135010388) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (E)-3-[(1R,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol.
| Compound Name | (E)-3-[(1R,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 135010388 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (E)-3-[(1R,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
| SMILES | C=C[C@H]1CCCC[C@H]1/C=C(\CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H32O2Si/c1-5-15-11-9-10-12-16(15)13-17(14-18)19-20(6-2,7-3)8-4/h5,13,15-16,18H,1,6-12,14H2,2-4H3/b17-13+/t15-,16-/m0/s1 |
| InChIKey | FWPSSJSISRNBOC-WPKOWNOESA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|