C13H11NO3 — CID 135010804
(3S)-1-methyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione (PubChem CID 135010804) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is (3S)-1-methyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione.
| Compound Name | (3S)-1-methyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 135010804 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (3S)-1-methyl-3'-methylidenespiro[indole-3,4'-oxolane]-2,2'-dione |
| SMILES | C=C1C(=O)OC[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C13H11NO3/c1-8-11(15)17-7-13(8)9-5-3-4-6-10(9)14(2)12(13)16/h3-6H,1,7H2,2H3/t13-/m1/s1 |
| InChIKey | WSUDNMIRHKHNOX-CYBMUJFWSA-N |
| XLogP | 1.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|