C16H12F3NO5 — CID 134948779
methyl (2S,3S)-4-formyl-1'-methyl-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate (PubChem CID 134948779) has the molecular formula C16H12F3NO5 and a molecular weight of 355.27 g/mol. Its IUPAC name is methyl (2S,3S)-4-formyl-1'-methyl-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate.
| Compound Name | methyl (2S,3S)-4-formyl-1'-methyl-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 134948779 |
| Molecular Formula | C16H12F3NO5 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | methyl (2S,3S)-4-formyl-1'-methyl-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C(F)(F)F)OC=C(C=O)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C16H12F3NO5/c1-20-11-6-4-3-5-10(11)14(12(20)22)9(7-21)8-25-15(14,13(23)24-2)16(17,18)19/h3-8H,1-2H3/t14-,15+/m0/s1 |
| InChIKey | QHAFJNVTUWPBJA-LSDHHAIUSA-N |
| XLogP | 1.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|