C22H15F2NO3 — CID 134948766
(4S,5S)-5-(difluoromethyl)-1'-methyl-2'-oxo-5-(2-phenylethynyl)spiro[furan-4,3'-indole]-3-carbaldehyde (PubChem CID 134948766) has the molecular formula C22H15F2NO3 and a molecular weight of 379.36 g/mol. Its IUPAC name is (4S,5S)-5-(difluoromethyl)-1'-methyl-2'-oxo-5-(2-phenylethynyl)spiro[furan-4,3'-indole]-3-carbaldehyde.
| Compound Name | (4S,5S)-5-(difluoromethyl)-1'-methyl-2'-oxo-5-(2-phenylethynyl)spiro[furan-4,3'-indole]-3-carbaldehyde |
|---|---|
| PubChem CID | 134948766 |
| Molecular Formula | C22H15F2NO3 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (4S,5S)-5-(difluoromethyl)-1'-methyl-2'-oxo-5-(2-phenylethynyl)spiro[furan-4,3'-indole]-3-carbaldehyde |
| SMILES | CN1C(=O)[C@]2(C(C=O)=CO[C@]2(C#Cc2ccccc2)C(F)F)c2ccccc21 |
| InChI | InChI=1S/C22H15F2NO3/c1-25-18-10-6-5-9-17(18)22(20(25)27)16(13-26)14-28-21(22,19(23)24)12-11-15-7-3-2-4-8-15/h2-10,13-14,19H,1H3/t21-,22+/m1/s1 |
| InChIKey | VRYLGGCSCFSXNJ-YADHBBJMSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|