About 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one
1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one (PubChem CID 23337736) has the molecular formula C20H21NO2
and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one.
Molecular Properties
| Compound Name | 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one |
| PubChem CID | 23337736 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one |
| SMILES | CC1(C)OCCC12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C20H21NO2/c1-19(2)20(12-13-23-19)16-10-6-7-11-17(16)21(18(20)22)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3 |
| InChIKey | LNPMKUPFTQJRRR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one?
The IUPAC name of 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one (CID 23337736) is 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one.
What is the SMILES notation for 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one?
The canonical SMILES for 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one is CC1(C)OCCC12C(=O)N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one?
The InChIKey is LNPMKUPFTQJRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO2/c1-19(2)20(12-13-23-19)16-10-6-7-11-17(16)21(18(20)22)14-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3.
What are the key properties of 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one?
1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one has a molecular weight of 307.39 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2',2'-dimethylspiro[indole-3,3'-oxolane]-2-one is sourced from PubChem (CID 23337736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).