C16H13NO4 — CID 135012809
(3'E)-1-methyl-3'-(prop-2-ynoxymethylidene)spiro[indole-3,4'-oxolane]-2,2'-dione (PubChem CID 135012809) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (3'E)-1-methyl-3'-(prop-2-ynoxymethylidene)spiro[indole-3,4'-oxolane]-2,2'-dione.
| Compound Name | (3'E)-1-methyl-3'-(prop-2-ynoxymethylidene)spiro[indole-3,4'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 135012809 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3'E)-1-methyl-3'-(prop-2-ynoxymethylidene)spiro[indole-3,4'-oxolane]-2,2'-dione |
| SMILES | C#CCO/C=C1/C(=O)OCC12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C16H13NO4/c1-3-8-20-9-12-14(18)21-10-16(12)11-6-4-5-7-13(11)17(2)15(16)19/h1,4-7,9H,8,10H2,2H3/b12-9- |
| InChIKey | OYQNBUTWUCGYLX-XFXZXTDPSA-N |
| XLogP | 0.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|