C16H13NO4 — CID 135015958
1-methyl-2,2'-dioxo-3'-propa-1,2-dienylspiro[indole-3,4'-oxolane]-3'-carbaldehyde (PubChem CID 135015958) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-methyl-2,2'-dioxo-3'-propa-1,2-dienylspiro[indole-3,4'-oxolane]-3'-carbaldehyde.
| Compound Name | 1-methyl-2,2'-dioxo-3'-propa-1,2-dienylspiro[indole-3,4'-oxolane]-3'-carbaldehyde |
|---|---|
| PubChem CID | 135015958 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-methyl-2,2'-dioxo-3'-propa-1,2-dienylspiro[indole-3,4'-oxolane]-3'-carbaldehyde |
| SMILES | C=C=CC1(C=O)C(=O)OCC12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C16H13NO4/c1-3-8-15(9-18)14(20)21-10-16(15)11-6-4-5-7-12(11)17(2)13(16)19/h4-9H,1,10H2,2H3 |
| InChIKey | RUJOZHLCNVHZFH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|