C20H29NO5 — CID 135011600
N-[[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl]prop-2-yn-1-amine (PubChem CID 135011600) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl]prop-2-yn-1-amine.
| Compound Name | N-[[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 135011600 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl]prop-2-yn-1-amine |
| SMILES | C#CCNC[C@@H]1O[C@@](C)(OC)[C@](C)(OC)OC1COCc1ccccc1 |
| InChI | InChI=1S/C20H29NO5/c1-6-12-21-13-17-18(15-24-14-16-10-8-7-9-11-16)26-20(3,23-5)19(2,22-4)25-17/h1,7-11,17-18,21H,12-15H2,2-5H3/t17-,18?,19+,20+/m0/s1 |
| InChIKey | AGSNXGWXZNJXCH-LTLCQPOLSA-N |
| XLogP | 1.94 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|