C23H21N3O2S2 — CID 135012992
1-[(2-hydroxynaphthalen-1-yl)-(5-methylthiophen-2-yl)methyl]-3-[(E)-(5-methylthiophen-2-yl)methylideneamino]urea (PubChem CID 135012992) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[(2-hydroxynaphthalen-1-yl)-(5-methylthiophen-2-yl)methyl]-3-[(E)-(5-methylthiophen-2-yl)methylideneamino]urea.
| Compound Name | 1-[(2-hydroxynaphthalen-1-yl)-(5-methylthiophen-2-yl)methyl]-3-[(E)-(5-methylthiophen-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 135012992 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-[(2-hydroxynaphthalen-1-yl)-(5-methylthiophen-2-yl)methyl]-3-[(E)-(5-methylthiophen-2-yl)methylideneamino]urea |
| SMILES | Cc1ccc(/C=N/NC(=O)NC(c2ccc(C)s2)c2c(O)ccc3ccccc23)s1 |
| InChI | InChI=1S/C23H21N3O2S2/c1-14-7-10-17(29-14)13-24-26-23(28)25-22(20-12-8-15(2)30-20)21-18-6-4-3-5-16(18)9-11-19(21)27/h3-13,22,27H,1-2H3,(H2,25,26,28)/b24-13+ |
| InChIKey | FQRFGSACRPMKLE-ZMOGYAJESA-N |
| XLogP | 5.71 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|