C25H19N5O6 — CID 24873772
1-[(2-hydroxynaphthalen-1-yl)-(3-nitrophenyl)methyl]-3-[(E)-(3-nitrophenyl)methylideneamino]urea (PubChem CID 24873772) has the molecular formula C25H19N5O6 and a molecular weight of 485.46 g/mol. Its IUPAC name is 1-[(2-hydroxynaphthalen-1-yl)-(3-nitrophenyl)methyl]-3-[(E)-(3-nitrophenyl)methylideneamino]urea.
| Compound Name | 1-[(2-hydroxynaphthalen-1-yl)-(3-nitrophenyl)methyl]-3-[(E)-(3-nitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 24873772 |
| Molecular Formula | C25H19N5O6 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[(2-hydroxynaphthalen-1-yl)-(3-nitrophenyl)methyl]-3-[(E)-(3-nitrophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1cccc([N+](=O)[O-])c1)NC(c1cccc([N+](=O)[O-])c1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H19N5O6/c31-22-12-11-17-6-1-2-10-21(17)23(22)24(18-7-4-9-20(14-18)30(35)36)27-25(32)28-26-15-16-5-3-8-19(13-16)29(33)34/h1-15,24,31H,(H2,27,28,32)/b26-15+ |
| InChIKey | BLEGYOZXRBWXOO-CVKSISIWSA-N |
| XLogP | 4.78 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|