C25H19Cl2N3O2 — CID 135013334
1-[(3-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-[(E)-(4-chlorophenyl)methylideneamino]urea (PubChem CID 135013334) has the molecular formula C25H19Cl2N3O2 and a molecular weight of 464.35 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-[(E)-(4-chlorophenyl)methylideneamino]urea.
| Compound Name | 1-[(3-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-[(E)-(4-chlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135013334 |
| Molecular Formula | C25H19Cl2N3O2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 1-[(3-chlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-[(E)-(4-chlorophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)NC(c1cccc(Cl)c1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H19Cl2N3O2/c26-19-11-8-16(9-12-19)15-28-30-25(32)29-24(18-5-3-6-20(27)14-18)23-21-7-2-1-4-17(21)10-13-22(23)31/h1-15,24,31H,(H2,29,30,32)/b28-15+ |
| InChIKey | NSLPOFZYLZKWIB-RWPZCVJISA-N |
| XLogP | 6.27 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|