C22H17NO5 — CID 135013423
methyl (Z)-7-(1,3-dioxoisoindol-2-yl)oxy-7-phenylhept-2-en-4-ynoate (PubChem CID 135013423) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl (Z)-7-(1,3-dioxoisoindol-2-yl)oxy-7-phenylhept-2-en-4-ynoate.
| Compound Name | methyl (Z)-7-(1,3-dioxoisoindol-2-yl)oxy-7-phenylhept-2-en-4-ynoate |
|---|---|
| PubChem CID | 135013423 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | methyl (Z)-7-(1,3-dioxoisoindol-2-yl)oxy-7-phenylhept-2-en-4-ynoate |
| SMILES | COC(=O)/C=C\C#CCC(ON1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H17NO5/c1-27-20(24)15-7-3-6-14-19(16-10-4-2-5-11-16)28-23-21(25)17-12-8-9-13-18(17)22(23)26/h2,4-5,7-13,15,19H,14H2,1H3/b15-7- |
| InChIKey | FYNAUZXYYOBIPT-CHHVJCJISA-N |
| XLogP | 3.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|