C15H18N2O6 — CID 89165362
2-(1,3-dioxoisoindol-2-yl)oxy-6-(methoxyamino)hexanoic acid (PubChem CID 89165362) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)oxy-6-(methoxyamino)hexanoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)oxy-6-(methoxyamino)hexanoic acid |
|---|---|
| PubChem CID | 89165362 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)oxy-6-(methoxyamino)hexanoic acid |
| SMILES | CONCCCCC(ON1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C15H18N2O6/c1-22-16-9-5-4-8-12(15(20)21)23-17-13(18)10-6-2-3-7-11(10)14(17)19/h2-3,6-7,12,16H,4-5,8-9H2,1H3,(H,20,21) |
| InChIKey | IHBGGVUGGSCJGW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|