C17H32O6Si — CID 135014807
[(E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enyl] methyl carbonate (PubChem CID 135014807) has the molecular formula C17H32O6Si and a molecular weight of 360.52 g/mol. Its IUPAC name is [(E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enyl] methyl carbonate.
| Compound Name | [(E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 135014807 |
| Molecular Formula | C17H32O6Si |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(E,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-triethylsilyloxybut-2-enyl] methyl carbonate |
| SMILES | CC[Si](CC)(CC)O[C@@H](/C=C/COC(=O)OC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H32O6Si/c1-7-24(8-2,9-3)23-14(11-10-12-20-16(18)19-6)15-13-21-17(4,5)22-15/h10-11,14-15H,7-9,12-13H2,1-6H3/b11-10+/t14-,15+/m0/s1 |
| InChIKey | UIFSTSQCWSQATI-KZGTWKPJSA-N |
| XLogP | 3.87 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|