C16H38O3Si2 — CID 135014913
(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropan-1-ol (PubChem CID 135014913) has the molecular formula C16H38O3Si2 and a molecular weight of 334.65 g/mol. Its IUPAC name is (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropan-1-ol.
| Compound Name | (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 135014913 |
| Molecular Formula | C16H38O3Si2 |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@](C)(CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H38O3Si2/c1-14(2,3)20(8,9)18-13-16(7,12-17)19-21(10,11)15(4,5)6/h17H,12-13H2,1-11H3/t16-/m1/s1 |
| InChIKey | CEMWHMUWVLOMON-MRXNPFEDSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|