C19H15NO3 — CID 135015139
8-(4-methylphenyl)-8,9-dihydro-7H-pyrano[3,2-f]quinoline-3,10-dione (PubChem CID 135015139) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 8-(4-methylphenyl)-8,9-dihydro-7H-pyrano[3,2-f]quinoline-3,10-dione.
| Compound Name | 8-(4-methylphenyl)-8,9-dihydro-7H-pyrano[3,2-f]quinoline-3,10-dione |
|---|---|
| PubChem CID | 135015139 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 8-(4-methylphenyl)-8,9-dihydro-7H-pyrano[3,2-f]quinoline-3,10-dione |
| SMILES | Cc1ccc(C2CC(=O)c3c(ccc4oc(=O)ccc34)N2)cc1 |
| InChI | InChI=1S/C19H15NO3/c1-11-2-4-12(5-3-11)15-10-16(21)19-13-6-9-18(22)23-17(13)8-7-14(19)20-15/h2-9,15,20H,10H2,1H3 |
| InChIKey | KVHCUMFWBPIUNO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|