C17H25NO3S — CID 135016688
[(4S)-4-[bis(prop-2-enyl)amino]-4-phenylbutan-2-yl] methanesulfonate (PubChem CID 135016688) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is [(4S)-4-[bis(prop-2-enyl)amino]-4-phenylbutan-2-yl] methanesulfonate.
| Compound Name | [(4S)-4-[bis(prop-2-enyl)amino]-4-phenylbutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 135016688 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(4S)-4-[bis(prop-2-enyl)amino]-4-phenylbutan-2-yl] methanesulfonate |
| SMILES | C=CCN(CC=C)[C@@H](CC(C)OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3S/c1-5-12-18(13-6-2)17(16-10-8-7-9-11-16)14-15(3)21-22(4,19)20/h5-11,15,17H,1-2,12-14H2,3-4H3/t15?,17-/m0/s1 |
| InChIKey | DPBGTWMZXMHKDV-LWKPJOBUSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|