C22H19NO3S — CID 135018228
(NZ)-4-methyl-N-(10-oxo-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),4(9),6,13-tetraenylidene)benzenesulfonamide (PubChem CID 135018228) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is (NZ)-4-methyl-N-(10-oxo-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),4(9),6,13-tetraenylidene)benzenesulfonamide.
| Compound Name | (NZ)-4-methyl-N-(10-oxo-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),4(9),6,13-tetraenylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 135018228 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (NZ)-4-methyl-N-(10-oxo-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),4(9),6,13-tetraenylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/C3=C(CC=CC3)C(=O)C3=C2C2C=CC3C2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c1-13-6-10-16(11-7-13)27(25,26)23-21-17-4-2-3-5-18(17)22(24)20-15-9-8-14(12-15)19(20)21/h2-3,6-11,14-15H,4-5,12H2,1H3/b23-21- |
| InChIKey | RTXWXORNJCSRJN-LNVKXUELSA-N |
| XLogP | 3.86 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|