C20H24O6S2 — CID 135019088
2-[(2R)-3,3-bis(benzenesulfonyl)-2-methylpropyl]-1,3-dioxane (PubChem CID 135019088) has the molecular formula C20H24O6S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[(2R)-3,3-bis(benzenesulfonyl)-2-methylpropyl]-1,3-dioxane.
| Compound Name | 2-[(2R)-3,3-bis(benzenesulfonyl)-2-methylpropyl]-1,3-dioxane |
|---|---|
| PubChem CID | 135019088 |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[(2R)-3,3-bis(benzenesulfonyl)-2-methylpropyl]-1,3-dioxane |
| SMILES | C[C@H](CC1OCCCO1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24O6S2/c1-16(15-19-25-13-8-14-26-19)20(27(21,22)17-9-4-2-5-10-17)28(23,24)18-11-6-3-7-12-18/h2-7,9-12,16,19-20H,8,13-15H2,1H3/t16-/m1/s1 |
| InChIKey | UJPKOULJPHXEPT-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |