C24H32O7S2 — CID 11730760
(E)-8,8-bis(benzenesulfonyl)-1,1-diethoxyoct-5-en-3-ol (PubChem CID 11730760) has the molecular formula C24H32O7S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is (E)-8,8-bis(benzenesulfonyl)-1,1-diethoxyoct-5-en-3-ol.
| Compound Name | (E)-8,8-bis(benzenesulfonyl)-1,1-diethoxyoct-5-en-3-ol |
|---|---|
| PubChem CID | 11730760 |
| Molecular Formula | C24H32O7S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (E)-8,8-bis(benzenesulfonyl)-1,1-diethoxyoct-5-en-3-ol |
| SMILES | CCOC(CC(O)C/C=C/CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C24H32O7S2/c1-3-30-23(31-4-2)19-20(25)13-11-12-18-24(32(26,27)21-14-7-5-8-15-21)33(28,29)22-16-9-6-10-17-22/h5-12,14-17,20,23-25H,3-4,13,18-19H2,1-2H3/b12-11+ |
| InChIKey | BFSAORMMZHBHIJ-VAWYXSNFSA-N |
| XLogP | 3.75 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|