C27H42O5S2 — CID 72511574
9-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)-9-methylsulfanylheptadeca-11,14-dien-8-ol (PubChem CID 72511574) has the molecular formula C27H42O5S2 and a molecular weight of 510.76 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)-9-methylsulfanylheptadeca-11,14-dien-8-ol.
| Compound Name | 9-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)-9-methylsulfanylheptadeca-11,14-dien-8-ol |
|---|---|
| PubChem CID | 72511574 |
| Molecular Formula | C27H42O5S2 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 9-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)-9-methylsulfanylheptadeca-11,14-dien-8-ol |
| SMILES | CCC=CCC=CCC(SC)(C(O)CCCCCCCC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H42O5S2/c1-3-4-5-6-10-16-21-27(33-2,34(29,30)24-17-12-11-13-18-24)25(28)19-14-8-7-9-15-20-26-31-22-23-32-26/h4-5,10-13,16-18,25-26,28H,3,6-9,14-15,19-23H2,1-2H3 |
| InChIKey | OYPGRRXNWSJCCY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|