C22H30O5S2 — CID 23389523
1-[2-[1-(2-hydroxy-3-phenylsulfanylpropoxy)ethoxy]ethoxy]-3-phenylsulfanylpropan-2-ol (PubChem CID 23389523) has the molecular formula C22H30O5S2 and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-[2-[1-(2-hydroxy-3-phenylsulfanylpropoxy)ethoxy]ethoxy]-3-phenylsulfanylpropan-2-ol.
| Compound Name | 1-[2-[1-(2-hydroxy-3-phenylsulfanylpropoxy)ethoxy]ethoxy]-3-phenylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 23389523 |
| Molecular Formula | C22H30O5S2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-[2-[1-(2-hydroxy-3-phenylsulfanylpropoxy)ethoxy]ethoxy]-3-phenylsulfanylpropan-2-ol |
| SMILES | CC(OCCOCC(O)CSc1ccccc1)OCC(O)CSc1ccccc1 |
| InChI | InChI=1S/C22H30O5S2/c1-18(27-15-20(24)17-29-22-10-6-3-7-11-22)26-13-12-25-14-19(23)16-28-21-8-4-2-5-9-21/h2-11,18-20,23-24H,12-17H2,1H3 |
| InChIKey | DSGUPGZBMAKCBP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|