About 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea
3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea (PubChem CID 135019305) has the molecular formula C18H16F6N2O
and a molecular weight of 390.33 g/mol. Its IUPAC name is 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea |
| PubChem CID | 135019305 |
| Molecular Formula | C18H16F6N2O |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(NC(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H16F6N2O/c1-10-4-5-14(15(6-10)25-16(27)26(2)3)11-7-12(17(19,20)21)9-13(8-11)18(22,23)24/h4-9H,1-3H3,(H,25,27) |
| InChIKey | PDMYZSPZYVLRNO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea (CID 135019305) is 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea is Cc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(NC(=O)N(C)C)c1.
What is the InChIKey of 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea?
The InChIKey is PDMYZSPZYVLRNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F6N2O/c1-10-4-5-14(15(6-10)25-16(27)26(2)3)11-7-12(17(19,20)21)9-13(8-11)18(22,23)24/h4-9H,1-3H3,(H,25,27).
What are the key properties of 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea?
3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea has a molecular weight of 390.33 g/mol, XLogP of 5.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3,5-bis(trifluoromethyl)phenyl]-5-methylphenyl]-1,1-dimethylurea is sourced from PubChem (CID 135019305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).