C24H30O9 — CID 135020146
methyl (1Z,3R,5S,8E,11R,13S,17R)-17-acetyloxy-3-hydroxy-13-methoxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1,8,14-triene-14-carboxylate (PubChem CID 135020146) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl (1Z,3R,5S,8E,11R,13S,17R)-17-acetyloxy-3-hydroxy-13-methoxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1,8,14-triene-14-carboxylate.
| Compound Name | methyl (1Z,3R,5S,8E,11R,13S,17R)-17-acetyloxy-3-hydroxy-13-methoxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1,8,14-triene-14-carboxylate |
|---|---|
| PubChem CID | 135020146 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl (1Z,3R,5S,8E,11R,13S,17R)-17-acetyloxy-3-hydroxy-13-methoxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1,8,14-triene-14-carboxylate |
| SMILES | C=C(C)[C@@H]1C/C=C2\C(=O)O[C@@H](C[C@@](C)(O)/C=C3/C=C(C(=O)OC)[C@](OC)(C1)O3)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C24H30O9/c1-13(2)15-7-8-17-20(31-14(3)25)19(32-21(17)26)12-23(4,28)11-16-9-18(22(27)29-5)24(10-15,30-6)33-16/h8-9,11,15,19-20,28H,1,7,10,12H2,2-6H3/b16-11-,17-8-/t15-,19+,20-,23+,24+/m1/s1 |
| InChIKey | VHZXGBMYLQSTOY-HGQHZPISSA-N |
| XLogP | 2.25 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|