C20H42O5Si — CID 135020785
[2-(2-methoxyethoxymethoxy)-3-(3-methyloxiran-2-yl)butoxy]-tri(propan-2-yl)silane (PubChem CID 135020785) has the molecular formula C20H42O5Si and a molecular weight of 390.64 g/mol. Its IUPAC name is [2-(2-methoxyethoxymethoxy)-3-(3-methyloxiran-2-yl)butoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-(2-methoxyethoxymethoxy)-3-(3-methyloxiran-2-yl)butoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135020785 |
| Molecular Formula | C20H42O5Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [2-(2-methoxyethoxymethoxy)-3-(3-methyloxiran-2-yl)butoxy]-tri(propan-2-yl)silane |
| SMILES | COCCOCOC(CO[Si](C(C)C)(C(C)C)C(C)C)C(C)C1OC1C |
| InChI | InChI=1S/C20H42O5Si/c1-14(2)26(15(3)4,16(5)6)24-12-19(17(7)20-18(8)25-20)23-13-22-11-10-21-9/h14-20H,10-13H2,1-9H3 |
| InChIKey | YPDPHHWDPCXWRC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|