C22H48O4Si2 — CID 135020679
trimethyl-[2-[[(2R,3R)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl]oxymethoxy]ethyl]silane (PubChem CID 135020679) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is trimethyl-[2-[[(2R,3R)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl]oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(2R,3R)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl]oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 135020679 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | trimethyl-[2-[[(2R,3R)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl]oxymethoxy]ethyl]silane |
| SMILES | CC(C)[Si](OC[C@H](OCOCC[Si](C)(C)C)[C@@H](C)[C@H]1O[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-16(2)28(17(3)4,18(5)6)25-14-21(19(7)22-20(8)26-22)24-15-23-12-13-27(9,10)11/h16-22H,12-15H2,1-11H3/t19-,20+,21+,22-/m1/s1 |
| InChIKey | DTVXOSAOUZJVLN-CLAROIROSA-N |
| XLogP | 6.30 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|