C24H42OSSi2 — CID 135020842
triethyl-[(1Z)-1-phenylsulfanyl-1-triethylsilylhexa-1,5-dien-3-yl]oxysilane (PubChem CID 135020842) has the molecular formula C24H42OSSi2 and a molecular weight of 434.84 g/mol. Its IUPAC name is triethyl-[(1Z)-1-phenylsulfanyl-1-triethylsilylhexa-1,5-dien-3-yl]oxysilane.
| Compound Name | triethyl-[(1Z)-1-phenylsulfanyl-1-triethylsilylhexa-1,5-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 135020842 |
| Molecular Formula | C24H42OSSi2 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | triethyl-[(1Z)-1-phenylsulfanyl-1-triethylsilylhexa-1,5-dien-3-yl]oxysilane |
| SMILES | C=CCC(/C=C(\Sc1ccccc1)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H42OSSi2/c1-8-18-22(25-28(12-5,13-6)14-7)21-24(27(9-2,10-3)11-4)26-23-19-16-15-17-20-23/h8,15-17,19-22H,1,9-14,18H2,2-7H3/b24-21+ |
| InChIKey | ZKKKDHRPPRNRLM-DARPEHSRSA-N |
| XLogP | 8.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|