C55H54O12S — CID 135022719
[(3R)-4,5-dibenzoyloxy-2-[[(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] benzoate (PubChem CID 135022719) has the molecular formula C55H54O12S and a molecular weight of 939.09 g/mol. Its IUPAC name is [(3R)-4,5-dibenzoyloxy-2-[[(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [(3R)-4,5-dibenzoyloxy-2-[[(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 135022719 |
| Molecular Formula | C55H54O12S |
| Molecular Weight | 939.09 g/mol |
| Exact Mass | 938.33 |
| IUPAC Name | [(3R)-4,5-dibenzoyloxy-2-[[(2R,4R,5R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] benzoate |
| SMILES | COC1OC(CS[C@@H]2C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C(COCc3ccccc3)O2)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C55H54O12S/c1-59-55-51(67-54(58)43-30-18-7-19-31-43)50(66-53(57)42-28-16-6-17-29-42)49(65-52(56)41-26-14-5-15-27-41)46(64-55)37-68-47-32-44(61-34-39-22-10-3-11-23-39)48(62-35-40-24-12-4-13-25-40)45(63-47)36-60-33-38-20-8-2-9-21-38/h2-31,44-51,55H,32-37H2,1H3/t44-,45?,46?,47-,48-,49+,50?,51?,55?/m1/s1 |
| InChIKey | VYCKNCDRYMYIHV-IPTOFWGMSA-N |
| XLogP | 9.27 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.09 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|