C13H16O3 — CID 135022848
(1'S,2S,6'S,8'R)-4'-hydroxyspiro[oxirane-2,9'-tricyclo[6.2.2.01,6]dodec-11-ene]-10'-one (PubChem CID 135022848) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (1'S,2S,6'S,8'R)-4'-hydroxyspiro[oxirane-2,9'-tricyclo[6.2.2.01,6]dodec-11-ene]-10'-one.
| Compound Name | (1'S,2S,6'S,8'R)-4'-hydroxyspiro[oxirane-2,9'-tricyclo[6.2.2.01,6]dodec-11-ene]-10'-one |
|---|---|
| PubChem CID | 135022848 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (1'S,2S,6'S,8'R)-4'-hydroxyspiro[oxirane-2,9'-tricyclo[6.2.2.01,6]dodec-11-ene]-10'-one |
| SMILES | O=C1[C@@]2(CO2)[C@H]2C=C[C@@]13CCC(O)C[C@@H]3C2 |
| InChI | InChI=1S/C13H16O3/c14-10-2-4-12-3-1-8(5-9(12)6-10)13(7-16-13)11(12)15/h1,3,8-10,14H,2,4-7H2/t8-,9-,10?,12-,13+/m0/s1 |
| InChIKey | QZICBLLXDCWGAH-CPUAZNTOSA-N |
| XLogP | 1.06 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|