C15H27N5O2P+ — CID 135022933
tert-butyl N-(N-(2-amino-1,3-dimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)anilino)carbamate (PubChem CID 135022933) has the molecular formula C15H27N5O2P+ and a molecular weight of 340.39 g/mol. Its IUPAC name is tert-butyl N-(N-(2-amino-1,3-dimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)anilino)carbamate.
| Compound Name | tert-butyl N-(N-(2-amino-1,3-dimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)anilino)carbamate |
|---|---|
| PubChem CID | 135022933 |
| Molecular Formula | C15H27N5O2P+ |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl N-(N-(2-amino-1,3-dimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)anilino)carbamate |
| SMILES | CN1CCN(C)[P+]1(N)N(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H26N5O2P/c1-15(2,3)22-14(21)17-20(13-9-7-6-8-10-13)23(16)18(4)11-12-19(23)5/h6-10H,11-12,16H2,1-5H3/p+1 |
| InChIKey | IPARXYNUIYTLAN-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|