C23H15O8- — CID 135023162
2-[(Z)-1-hydroxy-3-oxo-1-(2-oxochromen-3-yl)but-1-en-2-yl]-4-oxo-2,3-dihydrochromene-3-carboxylate (PubChem CID 135023162) has the molecular formula C23H15O8- and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-[(Z)-1-hydroxy-3-oxo-1-(2-oxochromen-3-yl)but-1-en-2-yl]-4-oxo-2,3-dihydrochromene-3-carboxylate.
| Compound Name | 2-[(Z)-1-hydroxy-3-oxo-1-(2-oxochromen-3-yl)but-1-en-2-yl]-4-oxo-2,3-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 135023162 |
| Molecular Formula | C23H15O8- |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-[(Z)-1-hydroxy-3-oxo-1-(2-oxochromen-3-yl)but-1-en-2-yl]-4-oxo-2,3-dihydrochromene-3-carboxylate |
| SMILES | CC(=O)/C(=C(\O)c1cc2ccccc2oc1=O)C1Oc2ccccc2C(=O)C1C(=O)[O-] |
| InChI | InChI=1S/C23H16O8/c1-11(24)17(20(26)14-10-12-6-2-4-8-15(12)31-23(14)29)21-18(22(27)28)19(25)13-7-3-5-9-16(13)30-21/h2-10,18,21,26H,1H3,(H,27,28)/p-1/b20-17+ |
| InChIKey | SKBKCUOEHKHOQX-LVZFUZTISA-M |
| XLogP | 1.66 |
| TPSA | 133.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|