C19H40O5Si — CID 135023555
tert-butyl-[(1S,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hexoxy]-dimethylsilane (PubChem CID 135023555) has the molecular formula C19H40O5Si and a molecular weight of 376.61 g/mol. Its IUPAC name is tert-butyl-[(1S,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135023555 |
| Molecular Formula | C19H40O5Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | tert-butyl-[(1S,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hexoxy]-dimethylsilane |
| SMILES | CCC[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1)OCOC |
| InChI | InChI=1S/C19H40O5Si/c1-10-11-15(21-14-20-7)12-16(17-13-22-19(5,6)23-17)24-25(8,9)18(2,3)4/h15-17H,10-14H2,1-9H3/t15-,16-,17+/m0/s1 |
| InChIKey | IVBSFXUGYGXPHA-YESZJQIVSA-N |
| XLogP | 4.71 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|