C28H38O5 — CID 135025900
(1R,7E,11S,12S)-14,16-dihydroxy-5,5,8,11-tetramethyl-12-(2-methylpropyl)-19-oxatetracyclo[9.8.0.04,6.013,18]nonadeca-7,13,15,17-tetraene-15,17-dicarbaldehyde (PubChem CID 135025900) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (1R,7E,11S,12S)-14,16-dihydroxy-5,5,8,11-tetramethyl-12-(2-methylpropyl)-19-oxatetracyclo[9.8.0.04,6.013,18]nonadeca-7,13,15,17-tetraene-15,17-dicarbaldehyde.
| Compound Name | (1R,7E,11S,12S)-14,16-dihydroxy-5,5,8,11-tetramethyl-12-(2-methylpropyl)-19-oxatetracyclo[9.8.0.04,6.013,18]nonadeca-7,13,15,17-tetraene-15,17-dicarbaldehyde |
|---|---|
| PubChem CID | 135025900 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1R,7E,11S,12S)-14,16-dihydroxy-5,5,8,11-tetramethyl-12-(2-methylpropyl)-19-oxatetracyclo[9.8.0.04,6.013,18]nonadeca-7,13,15,17-tetraene-15,17-dicarbaldehyde |
| SMILES | C/C1=C\C2C(CC[C@H]3Oc4c(C=O)c(O)c(C=O)c(O)c4[C@@H](CC(C)C)[C@]3(C)CC1)C2(C)C |
| InChI | InChI=1S/C28H38O5/c1-15(2)11-21-23-25(32)17(13-29)24(31)18(14-30)26(23)33-22-8-7-19-20(27(19,4)5)12-16(3)9-10-28(21,22)6/h12-15,19-22,31-32H,7-11H2,1-6H3/b16-12+/t19?,20?,21-,22-,28+/m1/s1 |
| InChIKey | VFPRSPBTOPDBHT-FQWCUKTKSA-N |
| XLogP | 6.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|